C14H7ClFNO2S — CID 71591739
6-chloro-3-(4-fluorophenyl)-4-sulfanylidene-1,3-benzoxazin-2-one (PubChem CID 71591739) has the molecular formula C14H7ClFNO2S and a molecular weight of 307.73 g/mol. Its IUPAC name is 6-chloro-3-(4-fluorophenyl)-4-sulfanylidene-1,3-benzoxazin-2-one.
| Compound Name | 6-chloro-3-(4-fluorophenyl)-4-sulfanylidene-1,3-benzoxazin-2-one |
|---|---|
| PubChem CID | 71591739 |
| Molecular Formula | C14H7ClFNO2S |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 6-chloro-3-(4-fluorophenyl)-4-sulfanylidene-1,3-benzoxazin-2-one |
| SMILES | O=c1oc2ccc(Cl)cc2c(=S)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H7ClFNO2S/c15-8-1-6-12-11(7-8)13(20)17(14(18)19-12)10-4-2-9(16)3-5-10/h1-7H |
| InChIKey | PRMMXBJMXQHSQN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|