C14H7ClFNOS2 — CID 71591845
6-chloro-3-(4-fluorophenyl)-1,3-benzoxazine-2,4-dithione (PubChem CID 71591845) has the molecular formula C14H7ClFNOS2 and a molecular weight of 323.80 g/mol. Its IUPAC name is 6-chloro-3-(4-fluorophenyl)-1,3-benzoxazine-2,4-dithione.
| Compound Name | 6-chloro-3-(4-fluorophenyl)-1,3-benzoxazine-2,4-dithione |
|---|---|
| PubChem CID | 71591845 |
| Molecular Formula | C14H7ClFNOS2 |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 6-chloro-3-(4-fluorophenyl)-1,3-benzoxazine-2,4-dithione |
| SMILES | Fc1ccc(-n2c(=S)oc3ccc(Cl)cc3c2=S)cc1 |
| InChI | InChI=1S/C14H7ClFNOS2/c15-8-1-6-12-11(7-8)13(19)17(14(20)18-12)10-4-2-9(16)3-5-10/h1-7H |
| InChIKey | HKQBGEXXGPMAHS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|