C15H10FNO2S2 — CID 102213235
3-(4-fluorophenyl)-7-methoxy-1,3-benzoxazine-2,4-dithione (PubChem CID 102213235) has the molecular formula C15H10FNO2S2 and a molecular weight of 319.38 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-7-methoxy-1,3-benzoxazine-2,4-dithione.
| Compound Name | 3-(4-fluorophenyl)-7-methoxy-1,3-benzoxazine-2,4-dithione |
|---|---|
| PubChem CID | 102213235 |
| Molecular Formula | C15H10FNO2S2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 3-(4-fluorophenyl)-7-methoxy-1,3-benzoxazine-2,4-dithione |
| SMILES | COc1ccc2c(=S)n(-c3ccc(F)cc3)c(=S)oc2c1 |
| InChI | InChI=1S/C15H10FNO2S2/c1-18-11-6-7-12-13(8-11)19-15(21)17(14(12)20)10-4-2-9(16)3-5-10/h2-8H,1H3 |
| InChIKey | HURYYUZHTQCJTN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 27.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|