C15H10ClNO3S — CID 102213228
3-(3-chlorophenyl)-7-methoxy-4-sulfanylidene-1,3-benzoxazin-2-one (PubChem CID 102213228) has the molecular formula C15H10ClNO3S and a molecular weight of 319.77 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-7-methoxy-4-sulfanylidene-1,3-benzoxazin-2-one.
| Compound Name | 3-(3-chlorophenyl)-7-methoxy-4-sulfanylidene-1,3-benzoxazin-2-one |
|---|---|
| PubChem CID | 102213228 |
| Molecular Formula | C15H10ClNO3S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 3-(3-chlorophenyl)-7-methoxy-4-sulfanylidene-1,3-benzoxazin-2-one |
| SMILES | COc1ccc2c(=S)n(-c3cccc(Cl)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C15H10ClNO3S/c1-19-11-5-6-12-13(8-11)20-15(18)17(14(12)21)10-4-2-3-9(16)7-10/h2-8H,1H3 |
| InChIKey | HGIMXYFATQKNRB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|