C15H11NO4S — CID 135928004
5-hydroxy-3-(4-methoxyphenyl)-4-sulfanylidene-1,3-benzoxazin-2-one (PubChem CID 135928004) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is 5-hydroxy-3-(4-methoxyphenyl)-4-sulfanylidene-1,3-benzoxazin-2-one.
| Compound Name | 5-hydroxy-3-(4-methoxyphenyl)-4-sulfanylidene-1,3-benzoxazin-2-one |
|---|---|
| PubChem CID | 135928004 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 5-hydroxy-3-(4-methoxyphenyl)-4-sulfanylidene-1,3-benzoxazin-2-one |
| SMILES | COc1ccc(-n2c(=O)oc3cccc(O)c3c2=S)cc1 |
| InChI | InChI=1S/C15H11NO4S/c1-19-10-7-5-9(6-8-10)16-14(21)13-11(17)3-2-4-12(13)20-15(16)18/h2-8,17H,1H3 |
| InChIKey | CQGWSAFRQNUPMJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|