C15H15NO4 — CID 16752230
3-(4-methoxyphenyl)-2-oxo-4,5,6,7-tetrahydro-1,3-benzoxazole-6-carbaldehyde (PubChem CID 16752230) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-oxo-4,5,6,7-tetrahydro-1,3-benzoxazole-6-carbaldehyde.
| Compound Name | 3-(4-methoxyphenyl)-2-oxo-4,5,6,7-tetrahydro-1,3-benzoxazole-6-carbaldehyde |
|---|---|
| PubChem CID | 16752230 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-oxo-4,5,6,7-tetrahydro-1,3-benzoxazole-6-carbaldehyde |
| SMILES | COc1ccc(-n2c3c(oc2=O)CC(C=O)CC3)cc1 |
| InChI | InChI=1S/C15H15NO4/c1-19-12-5-3-11(4-6-12)16-13-7-2-10(9-17)8-14(13)20-15(16)18/h3-6,9-10H,2,7-8H2,1H3 |
| InChIKey | JMAVEMJHMSLCPG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|