C14H17NO2 — CID 98116144
(1R,5R)-8-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 98116144) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is (1R,5R)-8-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,5R)-8-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 98116144 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (1R,5R)-8-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | COc1ccc(N2[C@@H]3CC[C@@H]2CC(=O)C3)cc1 |
| InChI | InChI=1S/C14H17NO2/c1-17-14-6-4-10(5-7-14)15-11-2-3-12(15)9-13(16)8-11/h4-7,11-12H,2-3,8-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | OWKLQIXASBHXKC-VXGBXAGGSA-N |
| XLogP | 2.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|