C17H18N2O — CID 168862821
12-(4-methoxyphenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 168862821) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 12-(4-methoxyphenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | 12-(4-methoxyphenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 168862821 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 12-(4-methoxyphenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | COc1ccc(N2C3CCC2c2cnccc2C3)cc1 |
| InChI | InChI=1S/C17H18N2O/c1-20-15-5-2-13(3-6-15)19-14-4-7-17(19)16-11-18-9-8-12(16)10-14/h2-3,5-6,8-9,11,14,17H,4,7,10H2,1H3 |
| InChIKey | HIITXRPLKZUMPV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|