C19H23NO4 — CID 122383311
(5S,7R,8R)-8-ethyl-3-(4-methoxyphenyl)-5,7-dimethyl-4,5,7,8-tetrahydrocyclohepta[d][1,3]oxazole-2,6-dione (PubChem CID 122383311) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (5S,7R,8R)-8-ethyl-3-(4-methoxyphenyl)-5,7-dimethyl-4,5,7,8-tetrahydrocyclohepta[d][1,3]oxazole-2,6-dione.
| Compound Name | (5S,7R,8R)-8-ethyl-3-(4-methoxyphenyl)-5,7-dimethyl-4,5,7,8-tetrahydrocyclohepta[d][1,3]oxazole-2,6-dione |
|---|---|
| PubChem CID | 122383311 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (5S,7R,8R)-8-ethyl-3-(4-methoxyphenyl)-5,7-dimethyl-4,5,7,8-tetrahydrocyclohepta[d][1,3]oxazole-2,6-dione |
| SMILES | CC[C@H]1c2oc(=O)n(-c3ccc(OC)cc3)c2C[C@H](C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C19H23NO4/c1-5-15-12(3)17(21)11(2)10-16-18(15)24-19(22)20(16)13-6-8-14(23-4)9-7-13/h6-9,11-12,15H,5,10H2,1-4H3/t11-,12+,15+/m0/s1 |
| InChIKey | FQXPHWISPZBQFD-YWPYICTPSA-N |
| XLogP | 3.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |