C16H11ClFNO3 — CID 66920511
2-chloro-1-(4-fluorophenyl)-6-methoxyindole-3-carboxylic acid (PubChem CID 66920511) has the molecular formula C16H11ClFNO3 and a molecular weight of 319.72 g/mol. Its IUPAC name is 2-chloro-1-(4-fluorophenyl)-6-methoxyindole-3-carboxylic acid.
| Compound Name | 2-chloro-1-(4-fluorophenyl)-6-methoxyindole-3-carboxylic acid |
|---|---|
| PubChem CID | 66920511 |
| Molecular Formula | C16H11ClFNO3 |
| Molecular Weight | 319.72 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-chloro-1-(4-fluorophenyl)-6-methoxyindole-3-carboxylic acid |
| SMILES | COc1ccc2c(C(=O)O)c(Cl)n(-c3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C16H11ClFNO3/c1-22-11-6-7-12-13(8-11)19(15(17)14(12)16(20)21)10-4-2-9(18)3-5-10/h2-8H,1H3,(H,20,21) |
| InChIKey | QQJNFVZNRKOZJL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.72 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |