C21H20FN3O4 — CID 19783731
6-fluoro-1-(4-methoxyphenyl)-4-oxo-2-piperazin-1-ylquinoline-3-carboxylic acid (PubChem CID 19783731) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is 6-fluoro-1-(4-methoxyphenyl)-4-oxo-2-piperazin-1-ylquinoline-3-carboxylic acid.
| Compound Name | 6-fluoro-1-(4-methoxyphenyl)-4-oxo-2-piperazin-1-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19783731 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 6-fluoro-1-(4-methoxyphenyl)-4-oxo-2-piperazin-1-ylquinoline-3-carboxylic acid |
| SMILES | COc1ccc(-n2c(N3CCNCC3)c(C(=O)O)c(=O)c3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C21H20FN3O4/c1-29-15-5-3-14(4-6-15)25-17-7-2-13(22)12-16(17)19(26)18(21(27)28)20(25)24-10-8-23-9-11-24/h2-7,12,23H,8-11H2,1H3,(H,27,28) |
| InChIKey | FRHZOUPWLRXGMT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |