C27H26FN3O3 — CID 52946960
[2-(5-fluoro-2-methylphenoxy)-6-methoxy-1-phenylindol-3-yl]-piperazin-1-ylmethanone (PubChem CID 52946960) has the molecular formula C27H26FN3O3 and a molecular weight of 459.52 g/mol. Its IUPAC name is [2-(5-fluoro-2-methylphenoxy)-6-methoxy-1-phenylindol-3-yl]-piperazin-1-ylmethanone.
| Compound Name | [2-(5-fluoro-2-methylphenoxy)-6-methoxy-1-phenylindol-3-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 52946960 |
| Molecular Formula | C27H26FN3O3 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | [2-(5-fluoro-2-methylphenoxy)-6-methoxy-1-phenylindol-3-yl]-piperazin-1-ylmethanone |
| SMILES | COc1ccc2c(C(=O)N3CCNCC3)c(Oc3cc(F)ccc3C)n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C27H26FN3O3/c1-18-8-9-19(28)16-24(18)34-27-25(26(32)30-14-12-29-13-15-30)22-11-10-21(33-2)17-23(22)31(27)20-6-4-3-5-7-20/h3-11,16-17,29H,12-15H2,1-2H3 |
| InChIKey | VYLVRENPOKYLIN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |