C26H28FN3O2 — CID 57404035
[1-[(1R)-cyclohex-2-en-1-yl]-2-(5-fluoro-2-methylphenoxy)indol-3-yl]-piperazin-1-ylmethanone (PubChem CID 57404035) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is [1-[(1R)-cyclohex-2-en-1-yl]-2-(5-fluoro-2-methylphenoxy)indol-3-yl]-piperazin-1-ylmethanone.
| Compound Name | [1-[(1R)-cyclohex-2-en-1-yl]-2-(5-fluoro-2-methylphenoxy)indol-3-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 57404035 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | [1-[(1R)-cyclohex-2-en-1-yl]-2-(5-fluoro-2-methylphenoxy)indol-3-yl]-piperazin-1-ylmethanone |
| SMILES | Cc1ccc(F)cc1Oc1c(C(=O)N2CCNCC2)c2ccccc2n1[C@H]1C=CCCC1 |
| InChI | InChI=1S/C26H28FN3O2/c1-18-11-12-19(27)17-23(18)32-26-24(25(31)29-15-13-28-14-16-29)21-9-5-6-10-22(21)30(26)20-7-3-2-4-8-20/h3,5-7,9-12,17,20,28H,2,4,8,13-16H2,1H3/t20-/m0/s1 |
| InChIKey | XGQGEYWNCFBSST-FQEVSTJZSA-N |
| XLogP | 5.21 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|