About (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone
(2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone (PubChem CID 82266893) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone.
Molecular Properties
| Compound Name | (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone |
| PubChem CID | 82266893 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone |
| SMILES | CCOc1c(C)ccc(C)c1C(=O)N1CCNCC1 |
| InChI | InChI=1S/C15H22N2O2/c1-4-19-14-12(3)6-5-11(2)13(14)15(18)17-9-7-16-8-10-17/h5-6,16H,4,7-10H2,1-3H3 |
| InChIKey | SOAAFTRXLJVMAS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone?
The IUPAC name of (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone (CID 82266893) is (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone.
What is the SMILES notation for (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone?
The canonical SMILES for (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone is CCOc1c(C)ccc(C)c1C(=O)N1CCNCC1.
What is the InChIKey of (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone?
The InChIKey is SOAAFTRXLJVMAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-4-19-14-12(3)6-5-11(2)13(14)15(18)17-9-7-16-8-10-17/h5-6,16H,4,7-10H2,1-3H3.
What are the key properties of (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone?
(2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone has a molecular weight of 262.35 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-3,6-dimethylphenyl)-piperazin-1-ylmethanone is sourced from PubChem (CID 82266893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).