C40H32N2O4S2 — CID 177244536
9-[4-[[4-(2,7-dimethoxycarbazol-9-yl)phenyl]disulfanyl]phenyl]-2,7-dimethoxycarbazole (PubChem CID 177244536) has the molecular formula C40H32N2O4S2 and a molecular weight of 668.84 g/mol. Its IUPAC name is 9-[4-[[4-(2,7-dimethoxycarbazol-9-yl)phenyl]disulfanyl]phenyl]-2,7-dimethoxycarbazole.
| Compound Name | 9-[4-[[4-(2,7-dimethoxycarbazol-9-yl)phenyl]disulfanyl]phenyl]-2,7-dimethoxycarbazole |
|---|---|
| PubChem CID | 177244536 |
| Molecular Formula | C40H32N2O4S2 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.18 |
| IUPAC Name | 9-[4-[[4-(2,7-dimethoxycarbazol-9-yl)phenyl]disulfanyl]phenyl]-2,7-dimethoxycarbazole |
| SMILES | COc1ccc2c3ccc(OC)cc3n(-c3ccc(SSc4ccc(-n5c6cc(OC)ccc6c6ccc(OC)cc65)cc4)cc3)c2c1 |
| InChI | InChI=1S/C40H32N2O4S2/c1-43-27-9-17-33-34-18-10-28(44-2)22-38(34)41(37(33)21-27)25-5-13-31(14-6-25)47-48-32-15-7-26(8-16-32)42-39-23-29(45-3)11-19-35(39)36-20-12-30(46-4)24-40(36)42/h5-24H,1-4H3 |
| InChIKey | YPGVRYFJDICURU-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|