C48H32N4O4 — CID 126727996
2-[1,5-bis[4-(3,6-dimethoxycarbazol-9-yl)phenyl]penta-1,4-diyn-3-ylidene]propanedinitrile (PubChem CID 126727996) has the molecular formula C48H32N4O4 and a molecular weight of 728.81 g/mol. Its IUPAC name is 2-[1,5-bis[4-(3,6-dimethoxycarbazol-9-yl)phenyl]penta-1,4-diyn-3-ylidene]propanedinitrile.
| Compound Name | 2-[1,5-bis[4-(3,6-dimethoxycarbazol-9-yl)phenyl]penta-1,4-diyn-3-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 126727996 |
| Molecular Formula | C48H32N4O4 |
| Molecular Weight | 728.81 g/mol |
| Exact Mass | 728.24 |
| IUPAC Name | 2-[1,5-bis[4-(3,6-dimethoxycarbazol-9-yl)phenyl]penta-1,4-diyn-3-ylidene]propanedinitrile |
| SMILES | COc1ccc2c(c1)c1cc(OC)ccc1n2-c1ccc(C#CC(C#Cc2ccc(-n3c4ccc(OC)cc4c4cc(OC)ccc43)cc2)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C48H32N4O4/c1-53-37-17-21-45-41(25-37)42-26-38(54-2)18-22-46(42)51(45)35-13-7-31(8-14-35)5-11-33(34(29-49)30-50)12-6-32-9-15-36(16-10-32)52-47-23-19-39(55-3)27-43(47)44-28-40(56-4)20-24-48(44)52/h7-10,13-28H,1-4H3 |
| InChIKey | UBRRKTVXEISCDT-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 94.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.81 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|