C23H16N2O4 — CID 146674997
dimethyl 9-(4-cyanophenyl)carbazole-3,6-dicarboxylate (PubChem CID 146674997) has the molecular formula C23H16N2O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is dimethyl 9-(4-cyanophenyl)carbazole-3,6-dicarboxylate.
| Compound Name | dimethyl 9-(4-cyanophenyl)carbazole-3,6-dicarboxylate |
|---|---|
| PubChem CID | 146674997 |
| Molecular Formula | C23H16N2O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | dimethyl 9-(4-cyanophenyl)carbazole-3,6-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1cc(C(=O)OC)ccc1n2-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H16N2O4/c1-28-22(26)15-5-9-20-18(11-15)19-12-16(23(27)29-2)6-10-21(19)25(20)17-7-3-14(13-24)4-8-17/h3-12H,1-2H3 |
| InChIKey | DJLUIOUJTWVRBH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 81.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |