C25H20N2O2 — CID 157037213
methyl 2-benzyl-4-phenylpyrrolo[3,4-b]indole-7-carboxylate (PubChem CID 157037213) has the molecular formula C25H20N2O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is methyl 2-benzyl-4-phenylpyrrolo[3,4-b]indole-7-carboxylate.
| Compound Name | methyl 2-benzyl-4-phenylpyrrolo[3,4-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 157037213 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | methyl 2-benzyl-4-phenylpyrrolo[3,4-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1cn(Cc3ccccc3)cc1n2-c1ccccc1 |
| InChI | InChI=1S/C25H20N2O2/c1-29-25(28)19-12-13-23-21(14-19)22-16-26(15-18-8-4-2-5-9-18)17-24(22)27(23)20-10-6-3-7-11-20/h2-14,16-17H,15H2,1H3 |
| InChIKey | OOIAAPZVZGGNDJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |