About methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate
methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate (PubChem CID 157038008) has the molecular formula C25H22N2O2
and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate |
| PubChem CID | 157038008 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate |
| SMILES | C=C/C=C(\C=C)Cn1cc2c3cc(C(=O)OC)ccc3n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C25H22N2O2/c1-4-9-18(5-2)15-26-16-22-21-14-19(25(28)29-3)12-13-23(21)27(24(22)17-26)20-10-7-6-8-11-20/h4-14,16-17H,1-2,15H2,3H3/b18-9+ |
| InChIKey | YEZJGQWPZONLJS-GIJQJNRQSA-N |
| XLogP | 5.67 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate?
The IUPAC name of methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate (CID 157038008) is methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate.
What is the SMILES notation for methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate?
The canonical SMILES for methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate is C=C/C=C(\C=C)Cn1cc2c3cc(C(=O)OC)ccc3n(-c3ccccc3)c2c1.
What is the InChIKey of methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate?
The InChIKey is YEZJGQWPZONLJS-GIJQJNRQSA-N. The full InChI is InChI=1S/C25H22N2O2/c1-4-9-18(5-2)15-26-16-22-21-14-19(25(28)29-3)12-13-23(21)27(24(22)17-26)20-10-7-6-8-11-20/h4-14,16-17H,1-2,15H2,3H3/b18-9+.
What are the key properties of methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate?
methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate has a molecular weight of 382.46 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2E)-2-ethenylpenta-2,4-dienyl]-4-phenylpyrrolo[3,4-b]indole-7-carboxylate is sourced from PubChem (CID 157038008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).