C18H19NO2 — CID 143672317
methyl 3-methyl-1-[(3Z)-2-methylidenehexa-3,5-dienyl]indole-5-carboxylate (PubChem CID 143672317) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is methyl 3-methyl-1-[(3Z)-2-methylidenehexa-3,5-dienyl]indole-5-carboxylate.
| Compound Name | methyl 3-methyl-1-[(3Z)-2-methylidenehexa-3,5-dienyl]indole-5-carboxylate |
|---|---|
| PubChem CID | 143672317 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | methyl 3-methyl-1-[(3Z)-2-methylidenehexa-3,5-dienyl]indole-5-carboxylate |
| SMILES | C=C/C=C\C(=C)Cn1cc(C)c2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C18H19NO2/c1-5-6-7-13(2)11-19-12-14(3)16-10-15(18(20)21-4)8-9-17(16)19/h5-10,12H,1-2,11H2,3-4H3/b7-6- |
| InChIKey | QILPBHKNOWMPPZ-SREVYHEPSA-N |
| XLogP | 4.03 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|