C25H22BNO2 — CID 177036038
[6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-phenylcarbazol-3-yl]boronic acid (PubChem CID 177036038) has the molecular formula C25H22BNO2 and a molecular weight of 379.27 g/mol. Its IUPAC name is [6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-phenylcarbazol-3-yl]boronic acid.
| Compound Name | [6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-phenylcarbazol-3-yl]boronic acid |
|---|---|
| PubChem CID | 177036038 |
| Molecular Formula | C25H22BNO2 |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | [6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-phenylcarbazol-3-yl]boronic acid |
| SMILES | C=C/C(=C\C=C/C)c1ccc2c(c1)c1cc(B(O)O)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C25H22BNO2/c1-3-5-9-18(4-2)19-12-14-24-22(16-19)23-17-20(26(28)29)13-15-25(23)27(24)21-10-7-6-8-11-21/h3-17,28-29H,2H2,1H3/b5-3-,18-9+ |
| InChIKey | ZVBPFIFVXFHBFL-HYKPSHSXSA-N |
| XLogP | 4.61 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|