C30H34BNO2 — CID 144825864
ethane;[2-ethyl-1,1-dimethyl-9-phenyl-3-[(Z)-prop-1-enyl]cyclopenta[b]carbazol-6-yl]boronic acid (PubChem CID 144825864) has the molecular formula C30H34BNO2 and a molecular weight of 451.42 g/mol. Its IUPAC name is ethane;[2-ethyl-1,1-dimethyl-9-phenyl-3-[(Z)-prop-1-enyl]cyclopenta[b]carbazol-6-yl]boronic acid.
| Compound Name | ethane;[2-ethyl-1,1-dimethyl-9-phenyl-3-[(Z)-prop-1-enyl]cyclopenta[b]carbazol-6-yl]boronic acid |
|---|---|
| PubChem CID | 144825864 |
| Molecular Formula | C30H34BNO2 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | ethane;[2-ethyl-1,1-dimethyl-9-phenyl-3-[(Z)-prop-1-enyl]cyclopenta[b]carbazol-6-yl]boronic acid |
| SMILES | C/C=C\C1=C(CC)C(C)(C)c2cc3c(cc21)c1cc(B(O)O)ccc1n3-c1ccccc1.CC |
| InChI | InChI=1S/C28H28BNO2.C2H6/c1-5-10-20-21-16-23-22-15-18(29(31)32)13-14-26(22)30(19-11-8-7-9-12-19)27(23)17-25(21)28(3,4)24(20)6-2;1-2/h5,7-17,31-32H,6H2,1-4H3;1-2H3/b10-5-; |
| InChIKey | MQYFKONNNVYEQY-WIMVAJRLSA-N |
| XLogP | 6.52 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|