(6,9-diphenylcarbazol-2-yl)boronic acid

C24H18BNO2 — CID 86770794

IUPAC(6,9-diphenylcarbazol-2-yl)boronic acid
SMILESOB(O)c1ccc2c3cc(-c4ccccc4)ccc3n(-c3ccccc3)c2c1
InChIInChI=1S/C24H18BNO2/c27-25(28)19-12-13-21-22-15-18(17-7-3-1-4-8-17)11-14-23(22)26(24(21)16-19)20-9-5-2-6-10-20/h1-16,27-28H
InChIKeyQQHFITRRVVVOOL-UHFFFAOYSA-N
MW363.23 g/mol
LogP4.13
Rot. Bonds3

About (6,9-diphenylcarbazol-2-yl)boronic acid

(6,9-diphenylcarbazol-2-yl)boronic acid (PubChem CID 86770794) has the molecular formula C24H18BNO2 and a molecular weight of 363.23 g/mol. Its IUPAC name is (6,9-diphenylcarbazol-2-yl)boronic acid.

Molecular Properties

Compound Name(6,9-diphenylcarbazol-2-yl)boronic acid
PubChem CID86770794
Molecular FormulaC24H18BNO2
Molecular Weight363.23 g/mol
Exact Mass363.14
IUPAC Name(6,9-diphenylcarbazol-2-yl)boronic acid
SMILESOB(O)c1ccc2c3cc(-c4ccccc4)ccc3n(-c3ccccc3)c2c1
InChIInChI=1S/C24H18BNO2/c27-25(28)19-12-13-21-22-15-18(17-7-3-1-4-8-17)11-14-23(22)26(24(21)16-19)20-9-5-2-6-10-20/h1-16,27-28H
InChIKeyQQHFITRRVVVOOL-UHFFFAOYSA-N
XLogP4.13
TPSA45.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.23
LogP ≤ 54.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (6,9-diphenylcarbazol-2-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6,9-diphenylcarbazol-2-yl)boronic acid?
The IUPAC name of (6,9-diphenylcarbazol-2-yl)boronic acid (CID 86770794) is (6,9-diphenylcarbazol-2-yl)boronic acid.
What is the SMILES notation for (6,9-diphenylcarbazol-2-yl)boronic acid?
The canonical SMILES for (6,9-diphenylcarbazol-2-yl)boronic acid is OB(O)c1ccc2c3cc(-c4ccccc4)ccc3n(-c3ccccc3)c2c1.
What is the InChIKey of (6,9-diphenylcarbazol-2-yl)boronic acid?
The InChIKey is QQHFITRRVVVOOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18BNO2/c27-25(28)19-12-13-21-22-15-18(17-7-3-1-4-8-17)11-14-23(22)26(24(21)16-19)20-9-5-2-6-10-20/h1-16,27-28H.
What are the key properties of (6,9-diphenylcarbazol-2-yl)boronic acid?
(6,9-diphenylcarbazol-2-yl)boronic acid has a molecular weight of 363.23 g/mol, XLogP of 4.13, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6,9-diphenylcarbazol-2-yl)boronic acid is sourced from PubChem (CID 86770794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).