[9-(3-phenylphenyl)carbazol-2-yl]boronic acid

C24H18BNO2 — CID 135743560

IUPAC[9-(3-phenylphenyl)carbazol-2-yl]boronic acid
SMILESOB(O)c1ccc2c3ccccc3n(-c3cccc(-c4ccccc4)c3)c2c1
InChIInChI=1S/C24H18BNO2/c27-25(28)19-13-14-22-21-11-4-5-12-23(21)26(24(22)16-19)20-10-6-9-18(15-20)17-7-2-1-3-8-17/h1-16,27-28H
InChIKeyJMUUCLJHGLGNAP-UHFFFAOYSA-N
MW363.23 g/mol
LogP4.13
Rot. Bonds3

About [9-(3-phenylphenyl)carbazol-2-yl]boronic acid

[9-(3-phenylphenyl)carbazol-2-yl]boronic acid (PubChem CID 135743560) has the molecular formula C24H18BNO2 and a molecular weight of 363.23 g/mol. Its IUPAC name is [9-(3-phenylphenyl)carbazol-2-yl]boronic acid.

Molecular Properties

Compound Name[9-(3-phenylphenyl)carbazol-2-yl]boronic acid
PubChem CID135743560
Molecular FormulaC24H18BNO2
Molecular Weight363.23 g/mol
Exact Mass363.14
IUPAC Name[9-(3-phenylphenyl)carbazol-2-yl]boronic acid
SMILESOB(O)c1ccc2c3ccccc3n(-c3cccc(-c4ccccc4)c3)c2c1
InChIInChI=1S/C24H18BNO2/c27-25(28)19-13-14-22-21-11-4-5-12-23(21)26(24(22)16-19)20-10-6-9-18(15-20)17-7-2-1-3-8-17/h1-16,27-28H
InChIKeyJMUUCLJHGLGNAP-UHFFFAOYSA-N
XLogP4.13
TPSA45.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.23
LogP ≤ 54.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [9-(3-phenylphenyl)carbazol-2-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [9-(3-phenylphenyl)carbazol-2-yl]boronic acid?
The IUPAC name of [9-(3-phenylphenyl)carbazol-2-yl]boronic acid (CID 135743560) is [9-(3-phenylphenyl)carbazol-2-yl]boronic acid.
What is the SMILES notation for [9-(3-phenylphenyl)carbazol-2-yl]boronic acid?
The canonical SMILES for [9-(3-phenylphenyl)carbazol-2-yl]boronic acid is OB(O)c1ccc2c3ccccc3n(-c3cccc(-c4ccccc4)c3)c2c1.
What is the InChIKey of [9-(3-phenylphenyl)carbazol-2-yl]boronic acid?
The InChIKey is JMUUCLJHGLGNAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18BNO2/c27-25(28)19-13-14-22-21-11-4-5-12-23(21)26(24(22)16-19)20-10-6-9-18(15-20)17-7-2-1-3-8-17/h1-16,27-28H.
What are the key properties of [9-(3-phenylphenyl)carbazol-2-yl]boronic acid?
[9-(3-phenylphenyl)carbazol-2-yl]boronic acid has a molecular weight of 363.23 g/mol, XLogP of 4.13, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(3-phenylphenyl)carbazol-2-yl]boronic acid is sourced from PubChem (CID 135743560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).