C35H25BN2O2 — CID 140790221
[9-[3-(4,6-diphenyl-2-pyridinyl)phenyl]carbazol-2-yl]boronic acid (PubChem CID 140790221) has the molecular formula C35H25BN2O2 and a molecular weight of 516.41 g/mol. Its IUPAC name is [9-[3-(4,6-diphenyl-2-pyridinyl)phenyl]carbazol-2-yl]boronic acid.
| Compound Name | [9-[3-(4,6-diphenyl-2-pyridinyl)phenyl]carbazol-2-yl]boronic acid |
|---|---|
| PubChem CID | 140790221 |
| Molecular Formula | C35H25BN2O2 |
| Molecular Weight | 516.41 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | [9-[3-(4,6-diphenyl-2-pyridinyl)phenyl]carbazol-2-yl]boronic acid |
| SMILES | OB(O)c1ccc2c3ccccc3n(-c3cccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)n4)c3)c2c1 |
| InChI | InChI=1S/C35H25BN2O2/c39-36(40)28-18-19-31-30-16-7-8-17-34(30)38(35(31)23-28)29-15-9-14-26(20-29)33-22-27(24-10-3-1-4-11-24)21-32(37-33)25-12-5-2-6-13-25/h1-23,39-40H |
| InChIKey | NZHKWOGGZAKTPW-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.41 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|