C50H42N2 — CID 156510474
3-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-2-methyl-8,9-dihydro-1-benzazonin-9-yl]-9-(3-phenylphenyl)carbazole (PubChem CID 156510474) has the molecular formula C50H42N2 and a molecular weight of 670.90 g/mol. Its IUPAC name is 3-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-2-methyl-8,9-dihydro-1-benzazonin-9-yl]-9-(3-phenylphenyl)carbazole.
| Compound Name | 3-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-2-methyl-8,9-dihydro-1-benzazonin-9-yl]-9-(3-phenylphenyl)carbazole |
|---|---|
| PubChem CID | 156510474 |
| Molecular Formula | C50H42N2 |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | 3-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-2-methyl-8,9-dihydro-1-benzazonin-9-yl]-9-(3-phenylphenyl)carbazole |
| SMILES | C=C/C(=C\C=C/C)c1ccc(-n2c(C)cccccc3c2C=CC(c2ccc4c(c2)c2ccccc2n4-c2cccc(-c4ccccc4)c2)C3)cc1 |
| InChI | InChI=1S/C50H42N2/c1-4-6-17-37(5-2)39-25-29-44(30-26-39)51-36(3)16-9-7-12-20-43-33-41(27-31-48(43)51)42-28-32-50-47(35-42)46-23-13-14-24-49(46)52(50)45-22-15-21-40(34-45)38-18-10-8-11-19-38/h4-32,34-35,41H,2,33H2,1,3H3/b6-4-,9-7-,20-12-,36-16-,37-17+ |
| InChIKey | MGRNHNFMZAKHFV-AGUWUKQNSA-N |
| XLogP | 13.17 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|