(5-cyano-9-phenylcarbazol-3-yl)boronic acid

C19H13BN2O2 — CID 178064371

IUPAC(5-cyano-9-phenylcarbazol-3-yl)boronic acid
SMILESN#Cc1cccc2c1c1cc(B(O)O)ccc1n2-c1ccccc1
InChIInChI=1S/C19H13BN2O2/c21-12-13-5-4-8-18-19(13)16-11-14(20(23)24)9-10-17(16)22(18)15-6-2-1-3-7-15/h1-11,23-24H
InChIKeyLYVCEOZEMJPBQG-UHFFFAOYSA-N
MW312.14 g/mol
LogP2.34
Rot. Bonds2

About (5-cyano-9-phenylcarbazol-3-yl)boronic acid

(5-cyano-9-phenylcarbazol-3-yl)boronic acid (PubChem CID 178064371) has the molecular formula C19H13BN2O2 and a molecular weight of 312.14 g/mol. Its IUPAC name is (5-cyano-9-phenylcarbazol-3-yl)boronic acid.

Molecular Properties

Compound Name(5-cyano-9-phenylcarbazol-3-yl)boronic acid
PubChem CID178064371
Molecular FormulaC19H13BN2O2
Molecular Weight312.14 g/mol
Exact Mass312.11
IUPAC Name(5-cyano-9-phenylcarbazol-3-yl)boronic acid
SMILESN#Cc1cccc2c1c1cc(B(O)O)ccc1n2-c1ccccc1
InChIInChI=1S/C19H13BN2O2/c21-12-13-5-4-8-18-19(13)16-11-14(20(23)24)9-10-17(16)22(18)15-6-2-1-3-7-15/h1-11,23-24H
InChIKeyLYVCEOZEMJPBQG-UHFFFAOYSA-N
XLogP2.34
TPSA69.18 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.14
LogP ≤ 52.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5-cyano-9-phenylcarbazol-3-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-cyano-9-phenylcarbazol-3-yl)boronic acid?
The IUPAC name of (5-cyano-9-phenylcarbazol-3-yl)boronic acid (CID 178064371) is (5-cyano-9-phenylcarbazol-3-yl)boronic acid.
What is the SMILES notation for (5-cyano-9-phenylcarbazol-3-yl)boronic acid?
The canonical SMILES for (5-cyano-9-phenylcarbazol-3-yl)boronic acid is N#Cc1cccc2c1c1cc(B(O)O)ccc1n2-c1ccccc1.
What is the InChIKey of (5-cyano-9-phenylcarbazol-3-yl)boronic acid?
The InChIKey is LYVCEOZEMJPBQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BN2O2/c21-12-13-5-4-8-18-19(13)16-11-14(20(23)24)9-10-17(16)22(18)15-6-2-1-3-7-15/h1-11,23-24H.
What are the key properties of (5-cyano-9-phenylcarbazol-3-yl)boronic acid?
(5-cyano-9-phenylcarbazol-3-yl)boronic acid has a molecular weight of 312.14 g/mol, XLogP of 2.34, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-9-phenylcarbazol-3-yl)boronic acid is sourced from PubChem (CID 178064371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).