C20H11N3 — CID 164818731
9-(4-isocyanophenyl)carbazole-4-carbonitrile (PubChem CID 164818731) has the molecular formula C20H11N3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 9-(4-isocyanophenyl)carbazole-4-carbonitrile.
| Compound Name | 9-(4-isocyanophenyl)carbazole-4-carbonitrile |
|---|---|
| PubChem CID | 164818731 |
| Molecular Formula | C20H11N3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 9-(4-isocyanophenyl)carbazole-4-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(-n2c3ccccc3c3c(C#N)cccc32)cc1 |
| InChI | InChI=1S/C20H11N3/c1-22-15-9-11-16(12-10-15)23-18-7-3-2-6-17(18)20-14(13-21)5-4-8-19(20)23/h2-12H |
| InChIKey | FLOUNWSECGRQBV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|