C32H29N — CID 144943286
3-[(3E,5E,8Z,10Z)-6-methyl-7-methylidenedodeca-1,3,5,8,10-pentaen-4-yl]-9-phenylcarbazole (PubChem CID 144943286) has the molecular formula C32H29N and a molecular weight of 427.59 g/mol. Its IUPAC name is 3-[(3E,5E,8Z,10Z)-6-methyl-7-methylidenedodeca-1,3,5,8,10-pentaen-4-yl]-9-phenylcarbazole.
| Compound Name | 3-[(3E,5E,8Z,10Z)-6-methyl-7-methylidenedodeca-1,3,5,8,10-pentaen-4-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 144943286 |
| Molecular Formula | C32H29N |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 3-[(3E,5E,8Z,10Z)-6-methyl-7-methylidenedodeca-1,3,5,8,10-pentaen-4-yl]-9-phenylcarbazole |
| SMILES | C=C/C=C(\C=C(\C)C(=C)/C=C\C=C/C)c1ccc2c(c1)c1ccccc1n2-c1ccccc1 |
| InChI | InChI=1S/C32H29N/c1-5-7-9-15-24(3)25(4)22-26(14-6-2)27-20-21-32-30(23-27)29-18-12-13-19-31(29)33(32)28-16-10-8-11-17-28/h5-23H,2-3H2,1,4H3/b7-5-,15-9-,25-22+,26-14+ |
| InChIKey | DTIPEIFOYSJCBC-MDWXTRFOSA-N |
| XLogP | 8.99 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|