C30H23N3 — CID 134188138
10-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-14-phenyl-2,10,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene (PubChem CID 134188138) has the molecular formula C30H23N3 and a molecular weight of 425.54 g/mol. Its IUPAC name is 10-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-14-phenyl-2,10,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene.
| Compound Name | 10-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-14-phenyl-2,10,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 134188138 |
| Molecular Formula | C30H23N3 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 10-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-14-phenyl-2,10,14-triazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaene |
| SMILES | C=C(/C=C\C=C/C)n1c2ccccc2c2nc3c4ccccc4n(-c4ccccc4)c3cc21 |
| InChI | InChI=1S/C30H23N3/c1-3-4-6-13-21(2)32-25-18-11-9-16-23(25)29-27(32)20-28-30(31-29)24-17-10-12-19-26(24)33(28)22-14-7-5-8-15-22/h3-20H,2H2,1H3/b4-3-,13-6- |
| InChIKey | AAAWKZJRIGGPOL-GBISSKHRSA-N |
| XLogP | 7.89 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|