C47H34N4 — CID 121462318
5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-phenylindeno[2,1-b]carbazole (PubChem CID 121462318) has the molecular formula C47H34N4 and a molecular weight of 654.82 g/mol. Its IUPAC name is 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-phenylindeno[2,1-b]carbazole.
| Compound Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-phenylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 121462318 |
| Molecular Formula | C47H34N4 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-phenylindeno[2,1-b]carbazole |
| SMILES | C=C(/C=C\C=C/C)C1(c2ccccc2)c2ccccc2-c2cc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3cc21 |
| InChI | InChI=1S/C47H34N4/c1-3-4-8-19-32(2)47(35-24-13-7-14-25-35)40-28-17-15-26-36(40)38-30-39-37-27-16-18-29-42(37)51(43(39)31-41(38)47)46-49-44(33-20-9-5-10-21-33)48-45(50-46)34-22-11-6-12-23-34/h3-31H,2H2,1H3/b4-3-,19-8- |
| InChIKey | OKTZJXHXAXQKIR-HOCACPDYSA-N |
| XLogP | 11.31 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|