C37H28N4 — CID 170201877
5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7,8-trimethylindeno[2,1-b]carbazole (PubChem CID 170201877) has the molecular formula C37H28N4 and a molecular weight of 528.66 g/mol. Its IUPAC name is 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7,8-trimethylindeno[2,1-b]carbazole.
| Compound Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7,8-trimethylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 170201877 |
| Molecular Formula | C37H28N4 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7,8-trimethylindeno[2,1-b]carbazole |
| SMILES | Cc1cccc2c1C(C)(C)c1cc3c(cc1-2)c1ccccc1n3-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C37H28N4/c1-23-13-12-19-27-28-21-29-26-18-10-11-20-31(26)41(32(29)22-30(28)37(2,3)33(23)27)36-39-34(24-14-6-4-7-15-24)38-35(40-36)25-16-8-5-9-17-25/h4-22H,1-3H3 |
| InChIKey | OMBVAAPGQDNVER-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |