C42H36N2 — CID 144976368
N-[(3Z,6Z,8Z)-5-methylidene-4-[(E)-2-(9-naphthalen-2-ylcarbazol-3-yl)prop-1-enyl]deca-1,3,6,8-tetraen-3-yl]aniline (PubChem CID 144976368) has the molecular formula C42H36N2 and a molecular weight of 568.76 g/mol. Its IUPAC name is N-[(3Z,6Z,8Z)-5-methylidene-4-[(E)-2-(9-naphthalen-2-ylcarbazol-3-yl)prop-1-enyl]deca-1,3,6,8-tetraen-3-yl]aniline.
| Compound Name | N-[(3Z,6Z,8Z)-5-methylidene-4-[(E)-2-(9-naphthalen-2-ylcarbazol-3-yl)prop-1-enyl]deca-1,3,6,8-tetraen-3-yl]aniline |
|---|---|
| PubChem CID | 144976368 |
| Molecular Formula | C42H36N2 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | N-[(3Z,6Z,8Z)-5-methylidene-4-[(E)-2-(9-naphthalen-2-ylcarbazol-3-yl)prop-1-enyl]deca-1,3,6,8-tetraen-3-yl]aniline |
| SMILES | C=C/C(Nc1ccccc1)=C(\C=C(/C)c1ccc2c(c1)c1ccccc1n2-c1ccc2ccccc2c1)C(=C)/C=C\C=C/C |
| InChI | InChI=1S/C42H36N2/c1-5-7-9-16-30(3)38(40(6-2)43-35-19-10-8-11-20-35)27-31(4)33-24-26-42-39(29-33)37-21-14-15-22-41(37)44(42)36-25-23-32-17-12-13-18-34(32)28-36/h5-29,43H,2-3H2,1,4H3/b7-5-,16-9-,31-27+,40-38- |
| InChIKey | XLAXRJCMONXCNJ-WFHDEROCSA-N |
| XLogP | 11.58 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|