C31H26N2O3 — CID 102319711
methyl 3-[(R)-benzamido(phenyl)methyl]-1-benzylindole-5-carboxylate (PubChem CID 102319711) has the molecular formula C31H26N2O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is methyl 3-[(R)-benzamido(phenyl)methyl]-1-benzylindole-5-carboxylate.
| Compound Name | methyl 3-[(R)-benzamido(phenyl)methyl]-1-benzylindole-5-carboxylate |
|---|---|
| PubChem CID | 102319711 |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | methyl 3-[(R)-benzamido(phenyl)methyl]-1-benzylindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c([C@H](NC(=O)c1ccccc1)c1ccccc1)cn2Cc1ccccc1 |
| InChI | InChI=1S/C31H26N2O3/c1-36-31(35)25-17-18-28-26(19-25)27(21-33(28)20-22-11-5-2-6-12-22)29(23-13-7-3-8-14-23)32-30(34)24-15-9-4-10-16-24/h2-19,21,29H,20H2,1H3,(H,32,34)/t29-/m1/s1 |
| InChIKey | HIEGIRFCXFKCHD-GDLZYMKVSA-N |
| XLogP | 6.00 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |