C29H23FN2O — CID 102319703
N-[(R)-(1-benzylindol-3-yl)-(4-fluorophenyl)methyl]benzamide (PubChem CID 102319703) has the molecular formula C29H23FN2O and a molecular weight of 434.51 g/mol. Its IUPAC name is N-[(R)-(1-benzylindol-3-yl)-(4-fluorophenyl)methyl]benzamide.
| Compound Name | N-[(R)-(1-benzylindol-3-yl)-(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 102319703 |
| Molecular Formula | C29H23FN2O |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[(R)-(1-benzylindol-3-yl)-(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(N[C@H](c1ccc(F)cc1)c1cn(Cc2ccccc2)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C29H23FN2O/c30-24-17-15-22(16-18-24)28(31-29(33)23-11-5-2-6-12-23)26-20-32(19-21-9-3-1-4-10-21)27-14-8-7-13-25(26)27/h1-18,20,28H,19H2,(H,31,33)/t28-/m1/s1 |
| InChIKey | KHTUYVRLSVUNQJ-MUUNZHRXSA-N |
| XLogP | 6.35 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |