C19H17NO4 — CID 802057
(2R)-2-(1-benzylindol-3-yl)butanedioic acid (PubChem CID 802057) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2R)-2-(1-benzylindol-3-yl)butanedioic acid.
| Compound Name | (2R)-2-(1-benzylindol-3-yl)butanedioic acid |
|---|---|
| PubChem CID | 802057 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2R)-2-(1-benzylindol-3-yl)butanedioic acid |
| SMILES | O=C(O)C[C@@H](C(=O)O)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C19H17NO4/c21-18(22)10-15(19(23)24)16-12-20(11-13-6-2-1-3-7-13)17-9-5-4-8-14(16)17/h1-9,12,15H,10-11H2,(H,21,22)(H,23,24)/t15-/m1/s1 |
| InChIKey | HBQIJLDPXWEWFR-OAHLLOKOSA-N |
| XLogP | 3.33 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |