C29H32N2O — CID 83279529
N-benzyl-3-(1-benzylindol-3-yl)-4,4-dimethylpentanamide (PubChem CID 83279529) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is N-benzyl-3-(1-benzylindol-3-yl)-4,4-dimethylpentanamide.
| Compound Name | N-benzyl-3-(1-benzylindol-3-yl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 83279529 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N-benzyl-3-(1-benzylindol-3-yl)-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)C(CC(=O)NCc1ccccc1)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C29H32N2O/c1-29(2,3)26(18-28(32)30-19-22-12-6-4-7-13-22)25-21-31(20-23-14-8-5-9-15-23)27-17-11-10-16-24(25)27/h4-17,21,26H,18-20H2,1-3H3,(H,30,32) |
| InChIKey | XETXESIPRTWMEM-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |