C35H36FN3O — CID 4299121
N-benzyl-3-(1-benzylindol-3-yl)-N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)propanamide (PubChem CID 4299121) has the molecular formula C35H36FN3O and a molecular weight of 533.69 g/mol. Its IUPAC name is N-benzyl-3-(1-benzylindol-3-yl)-N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | N-benzyl-3-(1-benzylindol-3-yl)-N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 4299121 |
| Molecular Formula | C35H36FN3O |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | N-benzyl-3-(1-benzylindol-3-yl)-N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)propanamide |
| SMILES | CN(C)CCN(Cc1ccccc1)C(=O)CC(c1ccc(F)cc1)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C35H36FN3O/c1-37(2)21-22-38(24-27-11-5-3-6-12-27)35(40)23-32(29-17-19-30(36)20-18-29)33-26-39(25-28-13-7-4-8-14-28)34-16-10-9-15-31(33)34/h3-20,26,32H,21-25H2,1-2H3 |
| InChIKey | XPYWADRYDBCLFS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |