C21H20N2O2 — CID 139537377
methyl 1-(2-cyanoethyl)-3-(2-phenylethyl)indole-5-carboxylate (PubChem CID 139537377) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 1-(2-cyanoethyl)-3-(2-phenylethyl)indole-5-carboxylate.
| Compound Name | methyl 1-(2-cyanoethyl)-3-(2-phenylethyl)indole-5-carboxylate |
|---|---|
| PubChem CID | 139537377 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | methyl 1-(2-cyanoethyl)-3-(2-phenylethyl)indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c(CCc1ccccc1)cn2CCC#N |
| InChI | InChI=1S/C21H20N2O2/c1-25-21(24)17-10-11-20-19(14-17)18(15-23(20)13-5-12-22)9-8-16-6-3-2-4-7-16/h2-4,6-7,10-11,14-15H,5,8-9,13H2,1H3 |
| InChIKey | HOKDDBSOAQBMOC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |