C20H21N3O4 — CID 139692050
methyl 3-(2-nitroethyl)-1-(3-pyridin-3-ylpropyl)indole-5-carboxylate (PubChem CID 139692050) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is methyl 3-(2-nitroethyl)-1-(3-pyridin-3-ylpropyl)indole-5-carboxylate.
| Compound Name | methyl 3-(2-nitroethyl)-1-(3-pyridin-3-ylpropyl)indole-5-carboxylate |
|---|---|
| PubChem CID | 139692050 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | methyl 3-(2-nitroethyl)-1-(3-pyridin-3-ylpropyl)indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c(CC[N+](=O)[O-])cn2CCCc1cccnc1 |
| InChI | InChI=1S/C20H21N3O4/c1-27-20(24)16-6-7-19-18(12-16)17(8-11-23(25)26)14-22(19)10-3-5-15-4-2-9-21-13-15/h2,4,6-7,9,12-14H,3,5,8,10-11H2,1H3 |
| InChIKey | LZVFQHIOXITWFB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|