methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate

C19H21N3O3 — CID 19572760

IUPACmethyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate
SMILESCOC(=O)c1ccc(C(=O)N2CCN(Cc3cccnc3)CC2)cc1
InChIInChI=1S/C19H21N3O3/c1-25-19(24)17-6-4-16(5-7-17)18(23)22-11-9-21(10-12-22)14-15-3-2-8-20-13-15/h2-8,13H,9-12,14H2,1H3
InChIKeyRVEZRNBIEPJOKF-UHFFFAOYSA-N
MW339.40 g/mol
LogP1.83
Rot. Bonds4

About methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate

methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate (PubChem CID 19572760) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate
PubChem CID19572760
Molecular FormulaC19H21N3O3
Molecular Weight339.40 g/mol
Exact Mass339.16
IUPAC Namemethyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate
SMILESCOC(=O)c1ccc(C(=O)N2CCN(Cc3cccnc3)CC2)cc1
InChIInChI=1S/C19H21N3O3/c1-25-19(24)17-6-4-16(5-7-17)18(23)22-11-9-21(10-12-22)14-15-3-2-8-20-13-15/h2-8,13H,9-12,14H2,1H3
InChIKeyRVEZRNBIEPJOKF-UHFFFAOYSA-N
XLogP1.83
TPSA62.74 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.40
LogP ≤ 51.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate?
The IUPAC name of methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate (CID 19572760) is methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate.
What is the SMILES notation for methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate?
The canonical SMILES for methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate is COC(=O)c1ccc(C(=O)N2CCN(Cc3cccnc3)CC2)cc1.
What is the InChIKey of methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate?
The InChIKey is RVEZRNBIEPJOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O3/c1-25-19(24)17-6-4-16(5-7-17)18(23)22-11-9-21(10-12-22)14-15-3-2-8-20-13-15/h2-8,13H,9-12,14H2,1H3.
What are the key properties of methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate?
methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate has a molecular weight of 339.40 g/mol, XLogP of 1.83, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate is sourced from PubChem (CID 19572760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).