C19H21N3O3 — CID 19572760
methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate (PubChem CID 19572760) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate.
| Compound Name | methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 19572760 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | methyl 4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCN(Cc3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-25-19(24)17-6-4-16(5-7-17)18(23)22-11-9-21(10-12-22)14-15-3-2-8-20-13-15/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | RVEZRNBIEPJOKF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |