C22H21BrN4O3 — CID 112834519
5-bromo-N-[4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]phenyl]furan-2-carboxamide (PubChem CID 112834519) has the molecular formula C22H21BrN4O3 and a molecular weight of 469.34 g/mol. Its IUPAC name is 5-bromo-N-[4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 112834519 |
| Molecular Formula | C22H21BrN4O3 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 5-bromo-N-[4-[4-(pyridin-3-ylmethyl)piperazine-1-carbonyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCN(Cc3cccnc3)CC2)cc1)c1ccc(Br)o1 |
| InChI | InChI=1S/C22H21BrN4O3/c23-20-8-7-19(30-20)21(28)25-18-5-3-17(4-6-18)22(29)27-12-10-26(11-13-27)15-16-2-1-9-24-14-16/h1-9,14H,10-13,15H2,(H,25,28) |
| InChIKey | SHZGOGMIKGKRAW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |