C15H16IN3OS — CID 78950056
(5-iodothiophen-3-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 78950056) has the molecular formula C15H16IN3OS and a molecular weight of 413.28 g/mol. Its IUPAC name is (5-iodothiophen-3-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (5-iodothiophen-3-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 78950056 |
| Molecular Formula | C15H16IN3OS |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | (5-iodothiophen-3-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1csc(I)c1)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C15H16IN3OS/c16-14-8-13(11-21-14)15(20)19-6-4-18(5-7-19)10-12-2-1-3-17-9-12/h1-3,8-9,11H,4-7,10H2 |
| InChIKey | YWPQOEVMHMTQDU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|