C21H19N2O4- — CID 18926531
(E)-3-[1-(3-methoxy-3-oxopropyl)-3-(pyridin-3-ylmethyl)indol-5-yl]prop-2-enoate (PubChem CID 18926531) has the molecular formula C21H19N2O4- and a molecular weight of 363.39 g/mol. Its IUPAC name is (E)-3-[1-(3-methoxy-3-oxopropyl)-3-(pyridin-3-ylmethyl)indol-5-yl]prop-2-enoate.
| Compound Name | (E)-3-[1-(3-methoxy-3-oxopropyl)-3-(pyridin-3-ylmethyl)indol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 18926531 |
| Molecular Formula | C21H19N2O4- |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (E)-3-[1-(3-methoxy-3-oxopropyl)-3-(pyridin-3-ylmethyl)indol-5-yl]prop-2-enoate |
| SMILES | COC(=O)CCn1cc(Cc2cccnc2)c2cc(/C=C/C(=O)[O-])ccc21 |
| InChI | InChI=1S/C21H20N2O4/c1-27-21(26)8-10-23-14-17(11-16-3-2-9-22-13-16)18-12-15(4-6-19(18)23)5-7-20(24)25/h2-7,9,12-14H,8,10-11H2,1H3,(H,24,25)/p-1/b7-5+ |
| InChIKey | QBUZWINXOOLARE-FNORWQNLSA-M |
| XLogP | 1.95 |
| TPSA | 84.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|