C19H22N4O4S — CID 18926537
3-[5-(dimethylsulfamoylamino)-3-(pyridin-3-ylmethyl)indol-1-yl]propanoic acid (PubChem CID 18926537) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 3-[5-(dimethylsulfamoylamino)-3-(pyridin-3-ylmethyl)indol-1-yl]propanoic acid.
| Compound Name | 3-[5-(dimethylsulfamoylamino)-3-(pyridin-3-ylmethyl)indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 18926537 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 3-[5-(dimethylsulfamoylamino)-3-(pyridin-3-ylmethyl)indol-1-yl]propanoic acid |
| SMILES | CN(C)S(=O)(=O)Nc1ccc2c(c1)c(Cc1cccnc1)cn2CCC(=O)O |
| InChI | InChI=1S/C19H22N4O4S/c1-22(2)28(26,27)21-16-5-6-18-17(11-16)15(10-14-4-3-8-20-12-14)13-23(18)9-7-19(24)25/h3-6,8,11-13,21H,7,9-10H2,1-2H3,(H,24,25) |
| InChIKey | KIISZWQMSNZJQS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |