C25H20N2O4 — CID 46894226
dimethyl 11-benzylindolizino[8,7-b]indole-2,5-dicarboxylate (PubChem CID 46894226) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is dimethyl 11-benzylindolizino[8,7-b]indole-2,5-dicarboxylate.
| Compound Name | dimethyl 11-benzylindolizino[8,7-b]indole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 46894226 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | dimethyl 11-benzylindolizino[8,7-b]indole-2,5-dicarboxylate |
| SMILES | COC(=O)c1cc2c3c(cc(C(=O)OC)n2c1)c1ccccc1n3Cc1ccccc1 |
| InChI | InChI=1S/C25H20N2O4/c1-30-24(28)17-12-21-23-19(13-22(25(29)31-2)26(21)15-17)18-10-6-7-11-20(18)27(23)14-16-8-4-3-5-9-16/h3-13,15H,14H2,1-2H3 |
| InChIKey | RFWFNIQJZHPMCX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |