C27H21N3O2S — CID 171777211
S-[(9-benzyl-1-methylpyrido[3,4-b]indole-3-carbonyl)amino] benzenecarbothioate (PubChem CID 171777211) has the molecular formula C27H21N3O2S and a molecular weight of 451.55 g/mol. Its IUPAC name is S-[(9-benzyl-1-methylpyrido[3,4-b]indole-3-carbonyl)amino] benzenecarbothioate.
| Compound Name | S-[(9-benzyl-1-methylpyrido[3,4-b]indole-3-carbonyl)amino] benzenecarbothioate |
|---|---|
| PubChem CID | 171777211 |
| Molecular Formula | C27H21N3O2S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | S-[(9-benzyl-1-methylpyrido[3,4-b]indole-3-carbonyl)amino] benzenecarbothioate |
| SMILES | Cc1nc(C(=O)NSC(=O)c2ccccc2)cc2c3ccccc3n(Cc3ccccc3)c12 |
| InChI | InChI=1S/C27H21N3O2S/c1-18-25-22(16-23(28-18)26(31)29-33-27(32)20-12-6-3-7-13-20)21-14-8-9-15-24(21)30(25)17-19-10-4-2-5-11-19/h2-16H,17H2,1H3,(H,29,31) |
| InChIKey | IHVVTQRHVHNYMG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|