C14H11N2NaO2 — CID 23663807
sodium 1,9-dimethylpyrido[3,4-b]indole-3-carboxylate (PubChem CID 23663807) has the molecular formula C14H11N2NaO2 and a molecular weight of 262.24 g/mol. Its IUPAC name is sodium 1,9-dimethylpyrido[3,4-b]indole-3-carboxylate.
| Compound Name | sodium 1,9-dimethylpyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 23663807 |
| Molecular Formula | C14H11N2NaO2 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | sodium 1,9-dimethylpyrido[3,4-b]indole-3-carboxylate |
| SMILES | Cc1nc(C(=O)[O-])cc2c3ccccc3n(C)c12.[Na+] |
| InChI | InChI=1S/C14H12N2O2.Na/c1-8-13-10(7-11(15-8)14(17)18)9-5-3-4-6-12(9)16(13)2;/h3-7H,1-2H3,(H,17,18);/q;+1/p-1 |
| InChIKey | RZUVFVWOKKVNIL-UHFFFAOYSA-M |
| XLogP | -1.60 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |