C26H21N3O2 — CID 172797690
1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 172797690) has the molecular formula C26H21N3O2 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 172797690 |
| Molecular Formula | C26H21N3O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | Cc1nc(C(=O)O)cc2c3cc(N(c4ccccc4)c4ccccc4)ccc3n(C)c12 |
| InChI | InChI=1S/C26H21N3O2/c1-17-25-22(16-23(27-17)26(30)31)21-15-20(13-14-24(21)28(25)2)29(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-16H,1-2H3,(H,30,31) |
| InChIKey | QKWYMDSYNLYTMF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |