About [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol
[1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol (PubChem CID 175716075) has the molecular formula C26H23N3O
and a molecular weight of 393.49 g/mol. Its IUPAC name is [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol.
Molecular Properties
| Compound Name | [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol |
| PubChem CID | 175716075 |
| Molecular Formula | C26H23N3O |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol |
| SMILES | Cc1nc(CO)cc2c3cc(N(c4ccccc4)c4ccccc4)ccc3n(C)c12 |
| InChI | InChI=1S/C26H23N3O/c1-18-26-24(15-19(17-30)27-18)23-16-22(13-14-25(23)28(26)2)29(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,30H,17H2,1-2H3 |
| InChIKey | ITCQHVJPFQRDRN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol?
The IUPAC name of [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol (CID 175716075) is [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol.
What is the SMILES notation for [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol?
The canonical SMILES for [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol is Cc1nc(CO)cc2c3cc(N(c4ccccc4)c4ccccc4)ccc3n(C)c12.
What is the InChIKey of [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol?
The InChIKey is ITCQHVJPFQRDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23N3O/c1-18-26-24(15-19(17-30)27-18)23-16-22(13-14-25(23)28(26)2)29(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,30H,17H2,1-2H3.
What are the key properties of [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol?
[1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol has a molecular weight of 393.49 g/mol, XLogP of 6.00, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol is sourced from PubChem (CID 175716075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).