C26H23N3O — CID 175716075
[1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol (PubChem CID 175716075) has the molecular formula C26H23N3O and a molecular weight of 393.49 g/mol. Its IUPAC name is [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol.
| Compound Name | [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol |
|---|---|
| PubChem CID | 175716075 |
| Molecular Formula | C26H23N3O |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | [1,9-dimethyl-6-(N-phenylanilino)pyrido[3,4-b]indol-3-yl]methanol |
| SMILES | Cc1nc(CO)cc2c3cc(N(c4ccccc4)c4ccccc4)ccc3n(C)c12 |
| InChI | InChI=1S/C26H23N3O/c1-18-26-24(15-19(17-30)27-18)23-16-22(13-14-25(23)28(26)2)29(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,30H,17H2,1-2H3 |
| InChIKey | ITCQHVJPFQRDRN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |